C18H34O3 — CID 134903309
6-(2-propyl-1,3-dioxolan-2-yl)dodecan-5-one (PubChem CID 134903309) has the molecular formula C18H34O3 and a molecular weight of 298.47 g/mol. Its IUPAC name is 6-(2-propyl-1,3-dioxolan-2-yl)dodecan-5-one.
| Compound Name | 6-(2-propyl-1,3-dioxolan-2-yl)dodecan-5-one |
|---|---|
| PubChem CID | 134903309 |
| Molecular Formula | C18H34O3 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.25 |
| IUPAC Name | 6-(2-propyl-1,3-dioxolan-2-yl)dodecan-5-one |
| SMILES | CCCCCCC(C(=O)CCCC)C1(CCC)OCCO1 |
| InChI | InChI=1S/C18H34O3/c1-4-7-9-10-11-16(17(19)12-8-5-2)18(13-6-3)20-14-15-21-18/h16H,4-15H2,1-3H3 |
| InChIKey | ZIMKOXJHJWKTIZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|