C12H20O4 — CID 14732298
3-(1,3-dioxolan-2-ylmethyl)octane-2,7-dione (PubChem CID 14732298) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is 3-(1,3-dioxolan-2-ylmethyl)octane-2,7-dione.
| Compound Name | 3-(1,3-dioxolan-2-ylmethyl)octane-2,7-dione |
|---|---|
| PubChem CID | 14732298 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 3-(1,3-dioxolan-2-ylmethyl)octane-2,7-dione |
| SMILES | CC(=O)CCCC(CC1OCCO1)C(C)=O |
| InChI | InChI=1S/C12H20O4/c1-9(13)4-3-5-11(10(2)14)8-12-15-6-7-16-12/h11-12H,3-8H2,1-2H3 |
| InChIKey | QGQWJIJALHPHCP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |