C19H32O7 — CID 25135927
4-O-[(4R)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-oxooctan-4-yl] 1-O-ethyl butanedioate (PubChem CID 25135927) has the molecular formula C19H32O7 and a molecular weight of 372.46 g/mol. Its IUPAC name is 4-O-[(4R)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-oxooctan-4-yl] 1-O-ethyl butanedioate.
| Compound Name | 4-O-[(4R)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-oxooctan-4-yl] 1-O-ethyl butanedioate |
|---|---|
| PubChem CID | 25135927 |
| Molecular Formula | C19H32O7 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 4-O-[(4R)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-oxooctan-4-yl] 1-O-ethyl butanedioate |
| SMILES | CCCC[C@](CCC=O)(OC(=O)CCC(=O)OCC)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C19H32O7/c1-5-7-11-19(12-8-13-20,15-14-24-18(3,4)25-15)26-17(22)10-9-16(21)23-6-2/h13,15H,5-12,14H2,1-4H3/t15-,19+/m0/s1 |
| InChIKey | NSWMSZVOXYGFLA-HNAYVOBHSA-N |
| XLogP | 2.93 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|