C21H42O4Si — CID 10949071
(4R)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(4S)-2,2-diethyl-1,3-dioxolan-4-yl]octanal (PubChem CID 10949071) has the molecular formula C21H42O4Si and a molecular weight of 386.65 g/mol. Its IUPAC name is (4R)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(4S)-2,2-diethyl-1,3-dioxolan-4-yl]octanal.
| Compound Name | (4R)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(4S)-2,2-diethyl-1,3-dioxolan-4-yl]octanal |
|---|---|
| PubChem CID | 10949071 |
| Molecular Formula | C21H42O4Si |
| Molecular Weight | 386.65 g/mol |
| Exact Mass | 386.29 |
| IUPAC Name | (4R)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(4S)-2,2-diethyl-1,3-dioxolan-4-yl]octanal |
| SMILES | CCCC[C@](CCC=O)(O[Si](C)(C)C(C)(C)C)[C@@H]1COC(CC)(CC)O1 |
| InChI | InChI=1S/C21H42O4Si/c1-9-12-14-20(15-13-16-22,25-26(7,8)19(4,5)6)18-17-23-21(10-2,11-3)24-18/h16,18H,9-15,17H2,1-8H3/t18-,20+/m0/s1 |
| InChIKey | CBYCJKVLISAVPR-AZUAARDMSA-N |
| XLogP | 5.85 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.65 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|