C27H54O6Si2 — CID 11145860
(4R,5R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-[(4S,5S)-2,2-dimethyl-5-(3-oxopropyl)-1,3-dioxolan-4-yl]heptanal (PubChem CID 11145860) has the molecular formula C27H54O6Si2 and a molecular weight of 530.90 g/mol. Its IUPAC name is (4R,5R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-[(4S,5S)-2,2-dimethyl-5-(3-oxopropyl)-1,3-dioxolan-4-yl]heptanal.
| Compound Name | (4R,5R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-[(4S,5S)-2,2-dimethyl-5-(3-oxopropyl)-1,3-dioxolan-4-yl]heptanal |
|---|---|
| PubChem CID | 11145860 |
| Molecular Formula | C27H54O6Si2 |
| Molecular Weight | 530.90 g/mol |
| Exact Mass | 530.35 |
| IUPAC Name | (4R,5R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-[(4S,5S)-2,2-dimethyl-5-(3-oxopropyl)-1,3-dioxolan-4-yl]heptanal |
| SMILES | CC1(C)O[C@@H](CCC=O)[C@H](CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CCC=O)O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C27H54O6Si2/c1-25(2,3)34(9,10)32-23(16-14-20-29)24(33-35(11,12)26(4,5)6)18-17-22-21(15-13-19-28)30-27(7,8)31-22/h19-24H,13-18H2,1-12H3/t21-,22-,23+,24+/m0/s1 |
| InChIKey | HXQSEEPYDXRIBZ-CJRSTVEYSA-N |
| XLogP | 7.03 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.90 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|