C26H54O6Si2 — CID 10391905
(2R)-3-[(2S,3R)-2-[(1R,2R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-methoxybutyl]-5-methoxyoxolan-3-yl]-2-methylpropanal (PubChem CID 10391905) has the molecular formula C26H54O6Si2 and a molecular weight of 518.88 g/mol. Its IUPAC name is (2R)-3-[(2S,3R)-2-[(1R,2R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-methoxybutyl]-5-methoxyoxolan-3-yl]-2-methylpropanal.
| Compound Name | (2R)-3-[(2S,3R)-2-[(1R,2R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-methoxybutyl]-5-methoxyoxolan-3-yl]-2-methylpropanal |
|---|---|
| PubChem CID | 10391905 |
| Molecular Formula | C26H54O6Si2 |
| Molecular Weight | 518.88 g/mol |
| Exact Mass | 518.35 |
| IUPAC Name | (2R)-3-[(2S,3R)-2-[(1R,2R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-methoxybutyl]-5-methoxyoxolan-3-yl]-2-methylpropanal |
| SMILES | COC1C[C@@H](C[C@@H](C)C=O)[C@@H]([C@@H](OC)[C@@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C26H54O6Si2/c1-19(18-27)16-20-17-22(28-8)31-23(20)24(29-9)21(32-34(12,13)26(5,6)7)14-15-30-33(10,11)25(2,3)4/h18-24H,14-17H2,1-13H3/t19-,20-,21-,22?,23+,24+/m1/s1 |
| InChIKey | CKYMOJZVHVTKKR-WDZMTYRSSA-N |
| XLogP | 6.41 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.88 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|