C20H40O4Si — CID 134863365
(4S,5S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethyl-5-(oxan-2-yloxy)heptanal (PubChem CID 134863365) has the molecular formula C20H40O4Si and a molecular weight of 372.62 g/mol. Its IUPAC name is (4S,5S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethyl-5-(oxan-2-yloxy)heptanal.
| Compound Name | (4S,5S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethyl-5-(oxan-2-yloxy)heptanal |
|---|---|
| PubChem CID | 134863365 |
| Molecular Formula | C20H40O4Si |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | (4S,5S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethyl-5-(oxan-2-yloxy)heptanal |
| SMILES | C[C@@H](CCC=O)[C@H](OC1CCCCO1)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40O4Si/c1-16(11-10-13-21)19(24-18-12-8-9-14-22-18)17(2)15-23-25(6,7)20(3,4)5/h13,16-19H,8-12,14-15H2,1-7H3/t16-,17-,18?,19-/m0/s1 |
| InChIKey | SGCDJOZITBBQNX-WPOPZESYSA-N |
| XLogP | 5.17 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|