C27H58O6Si3 — CID 10984591
(4S,5R)-2,2-dimethyl-5-[(1S,2R)-1,2,3-tris[[tert-butyl(dimethyl)silyl]oxy]propyl]-1,3-dioxolane-4-carbaldehyde (PubChem CID 10984591) has the molecular formula C27H58O6Si3 and a molecular weight of 563.01 g/mol. Its IUPAC name is (4S,5R)-2,2-dimethyl-5-[(1S,2R)-1,2,3-tris[[tert-butyl(dimethyl)silyl]oxy]propyl]-1,3-dioxolane-4-carbaldehyde.
| Compound Name | (4S,5R)-2,2-dimethyl-5-[(1S,2R)-1,2,3-tris[[tert-butyl(dimethyl)silyl]oxy]propyl]-1,3-dioxolane-4-carbaldehyde |
|---|---|
| PubChem CID | 10984591 |
| Molecular Formula | C27H58O6Si3 |
| Molecular Weight | 563.01 g/mol |
| Exact Mass | 562.35 |
| IUPAC Name | (4S,5R)-2,2-dimethyl-5-[(1S,2R)-1,2,3-tris[[tert-butyl(dimethyl)silyl]oxy]propyl]-1,3-dioxolane-4-carbaldehyde |
| SMILES | CC1(C)O[C@@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](C=O)O1 |
| InChI | InChI=1S/C27H58O6Si3/c1-24(2,3)34(12,13)29-19-21(32-35(14,15)25(4,5)6)23(33-36(16,17)26(7,8)9)22-20(18-28)30-27(10,11)31-22/h18,20-23H,19H2,1-17H3/t20-,21-,22-,23-/m1/s1 |
| InChIKey | YDBLORHBPBASDQ-SSGKUCQKSA-N |
| XLogP | 7.51 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.01 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|