C24H52O5Si3 — CID 134931206
(2S,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolane-2-carbaldehyde (PubChem CID 134931206) has the molecular formula C24H52O5Si3 and a molecular weight of 504.93 g/mol. Its IUPAC name is (2S,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolane-2-carbaldehyde.
| Compound Name | (2S,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 134931206 |
| Molecular Formula | C24H52O5Si3 |
| Molecular Weight | 504.93 g/mol |
| Exact Mass | 504.31 |
| IUPAC Name | (2S,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolane-2-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](C=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H52O5Si3/c1-22(2,3)30(10,11)26-17-19-21(29-32(14,15)24(7,8)9)20(18(16-25)27-19)28-31(12,13)23(4,5)6/h16,18-21H,17H2,1-15H3/t18-,19-,20-,21-/m1/s1 |
| InChIKey | IVGIXSPYBPMNHC-XRXFAXGQSA-N |
| XLogP | 6.76 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.93 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|