C17H32O5Si — CID 134838324
3-[(4R,6S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]propanal (PubChem CID 134838324) has the molecular formula C17H32O5Si and a molecular weight of 344.52 g/mol. Its IUPAC name is 3-[(4R,6S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]propanal.
| Compound Name | 3-[(4R,6S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]propanal |
|---|---|
| PubChem CID | 134838324 |
| Molecular Formula | C17H32O5Si |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 3-[(4R,6S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]propanal |
| SMILES | CC1(C)OC2C(O1)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H]2CCC=O |
| InChI | InChI=1S/C17H32O5Si/c1-16(2,3)23(6,7)19-11-13-15-14(21-17(4,5)22-15)12(20-13)9-8-10-18/h10,12-15H,8-9,11H2,1-7H3/t12-,13+,14?,15?/m0/s1 |
| InChIKey | XCWPPJUBRRXCGQ-ZUJMUWTESA-N |
| XLogP | 3.27 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|