C16H30O5Si — CID 10782678
(5S)-5-[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]oxolan-2-one (PubChem CID 10782678) has the molecular formula C16H30O5Si and a molecular weight of 330.50 g/mol. Its IUPAC name is (5S)-5-[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]oxolan-2-one.
| Compound Name | (5S)-5-[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]oxolan-2-one |
|---|---|
| PubChem CID | 10782678 |
| Molecular Formula | C16H30O5Si |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | (5S)-5-[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]oxolan-2-one |
| SMILES | CC1(C)OC[C@@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2CCC(=O)O2)O1 |
| InChI | InChI=1S/C16H30O5Si/c1-15(2,3)22(6,7)21-14(11-8-9-13(17)19-11)12-10-18-16(4,5)20-12/h11-12,14H,8-10H2,1-7H3/t11-,12-,14+/m0/s1 |
| InChIKey | FXOKNMOCWUWRDK-SGMGOOAPSA-N |
| XLogP | 3.23 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|