C17H34O6Si — CID 46894692
(5R,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-(2-methoxyethoxymethoxy)oxan-2-one (PubChem CID 46894692) has the molecular formula C17H34O6Si and a molecular weight of 362.54 g/mol. Its IUPAC name is (5R,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-(2-methoxyethoxymethoxy)oxan-2-one.
| Compound Name | (5R,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-(2-methoxyethoxymethoxy)oxan-2-one |
|---|---|
| PubChem CID | 46894692 |
| Molecular Formula | C17H34O6Si |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | (5R,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-(2-methoxyethoxymethoxy)oxan-2-one |
| SMILES | COCCOCO[C@@H]1CCC(=O)O[C@@H]1CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34O6Si/c1-17(2,3)24(5,6)22-10-9-15-14(7-8-16(18)23-15)21-13-20-12-11-19-4/h14-15H,7-13H2,1-6H3/t14-,15-/m1/s1 |
| InChIKey | XEPVSCUBSIAGHT-HUUCEWRRSA-N |
| XLogP | 3.11 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|