C25H54O5Si3 — CID 11226143
(4R,5S,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]oxan-2-one (PubChem CID 11226143) has the molecular formula C25H54O5Si3 and a molecular weight of 518.96 g/mol. Its IUPAC name is (4R,5S,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]oxan-2-one.
| Compound Name | (4R,5S,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]oxan-2-one |
|---|---|
| PubChem CID | 11226143 |
| Molecular Formula | C25H54O5Si3 |
| Molecular Weight | 518.96 g/mol |
| Exact Mass | 518.33 |
| IUPAC Name | (4R,5S,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]oxan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@@H]1OC(=O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H54O5Si3/c1-23(2,3)31(10,11)27-17-16-19-22(30-33(14,15)25(7,8)9)20(18-21(26)28-19)29-32(12,13)24(4,5)6/h19-20,22H,16-18H2,1-15H3/t19-,20+,22-/m0/s1 |
| InChIKey | SKSSBDDJQLSOKU-VWPQPMDRSA-N |
| XLogP | 7.49 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.96 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|