C22H42O7Si — CID 10873985
methyl 2-[(4R,6S)-6-[(2R)-5-acetyloxy-2-[tert-butyl(dimethyl)silyl]oxypentyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate (PubChem CID 10873985) has the molecular formula C22H42O7Si and a molecular weight of 446.66 g/mol. Its IUPAC name is methyl 2-[(4R,6S)-6-[(2R)-5-acetyloxy-2-[tert-butyl(dimethyl)silyl]oxypentyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate.
| Compound Name | methyl 2-[(4R,6S)-6-[(2R)-5-acetyloxy-2-[tert-butyl(dimethyl)silyl]oxypentyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 10873985 |
| Molecular Formula | C22H42O7Si |
| Molecular Weight | 446.66 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | methyl 2-[(4R,6S)-6-[(2R)-5-acetyloxy-2-[tert-butyl(dimethyl)silyl]oxypentyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| SMILES | COC(=O)C[C@H]1C[C@@H](C[C@@H](CCCOC(C)=O)O[Si](C)(C)C(C)(C)C)OC(C)(C)O1 |
| InChI | InChI=1S/C22H42O7Si/c1-16(23)26-12-10-11-17(29-30(8,9)21(2,3)4)13-18-14-19(15-20(24)25-7)28-22(5,6)27-18/h17-19H,10-15H2,1-9H3/t17-,18-,19-/m1/s1 |
| InChIKey | JOXMURAKRGIJDS-GUDVDZBRSA-N |
| XLogP | 4.58 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.66 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|