C19H34O6Si — CID 10475277
(2R)-2-[[(3aR,5R,6S,6aR)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl]oxan-3-one (PubChem CID 10475277) has the molecular formula C19H34O6Si and a molecular weight of 386.56 g/mol. Its IUPAC name is (2R)-2-[[(3aR,5R,6S,6aR)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl]oxan-3-one.
| Compound Name | (2R)-2-[[(3aR,5R,6S,6aR)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl]oxan-3-one |
|---|---|
| PubChem CID | 10475277 |
| Molecular Formula | C19H34O6Si |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | (2R)-2-[[(3aR,5R,6S,6aR)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl]oxan-3-one |
| SMILES | CC1(C)O[C@H]2O[C@H](C[C@H]3OCCCC3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O1 |
| InChI | InChI=1S/C19H34O6Si/c1-18(2,3)26(6,7)25-15-14(11-13-12(20)9-8-10-21-13)22-17-16(15)23-19(4,5)24-17/h13-17H,8-11H2,1-7H3/t13-,14-,15+,16-,17-/m1/s1 |
| InChIKey | OOTHJTMRSMJURS-NQNKBUKLSA-N |
| XLogP | 3.39 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|