C28H54O8Si2 — CID 10907950
(2R)-2-[(2S,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[(2S)-6-methoxy-3-oxooxan-2-yl]butyl]-6-methoxyoxan-3-one (PubChem CID 10907950) has the molecular formula C28H54O8Si2 and a molecular weight of 574.90 g/mol. Its IUPAC name is (2R)-2-[(2S,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[(2S)-6-methoxy-3-oxooxan-2-yl]butyl]-6-methoxyoxan-3-one.
| Compound Name | (2R)-2-[(2S,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[(2S)-6-methoxy-3-oxooxan-2-yl]butyl]-6-methoxyoxan-3-one |
|---|---|
| PubChem CID | 10907950 |
| Molecular Formula | C28H54O8Si2 |
| Molecular Weight | 574.90 g/mol |
| Exact Mass | 574.34 |
| IUPAC Name | (2R)-2-[(2S,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[(2S)-6-methoxy-3-oxooxan-2-yl]butyl]-6-methoxyoxan-3-one |
| SMILES | COC1CCC(=O)[C@H](C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C[C@H]2OC(OC)CCC2=O)O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C28H54O8Si2/c1-27(2,3)37(9,10)35-23(17-21-19(29)13-15-25(31-7)33-21)24(36-38(11,12)28(4,5)6)18-22-20(30)14-16-26(32-8)34-22/h21-26H,13-18H2,1-12H3/t21-,22+,23+,24-,25?,26? |
| InChIKey | QVXNQZIVUNARTH-SZQCZRFBSA-N |
| XLogP | 5.99 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.90 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|