C30H60O6Si2 — CID 11801227
1-[(2R,4S,6R,8S,10S)-4-[tert-butyl(dimethyl)silyl]oxy-10-methoxy-2-[tri(propan-2-yl)silyloxymethyl]-1,7-dioxaspiro[5.5]undecan-8-yl]butan-2-one (PubChem CID 11801227) has the molecular formula C30H60O6Si2 and a molecular weight of 572.98 g/mol. Its IUPAC name is 1-[(2R,4S,6R,8S,10S)-4-[tert-butyl(dimethyl)silyl]oxy-10-methoxy-2-[tri(propan-2-yl)silyloxymethyl]-1,7-dioxaspiro[5.5]undecan-8-yl]butan-2-one.
| Compound Name | 1-[(2R,4S,6R,8S,10S)-4-[tert-butyl(dimethyl)silyl]oxy-10-methoxy-2-[tri(propan-2-yl)silyloxymethyl]-1,7-dioxaspiro[5.5]undecan-8-yl]butan-2-one |
|---|---|
| PubChem CID | 11801227 |
| Molecular Formula | C30H60O6Si2 |
| Molecular Weight | 572.98 g/mol |
| Exact Mass | 572.39 |
| IUPAC Name | 1-[(2R,4S,6R,8S,10S)-4-[tert-butyl(dimethyl)silyl]oxy-10-methoxy-2-[tri(propan-2-yl)silyloxymethyl]-1,7-dioxaspiro[5.5]undecan-8-yl]butan-2-one |
| SMILES | CCC(=O)C[C@@H]1C[C@H](OC)C[C@@]2(C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](CO[Si](C(C)C)(C(C)C)C(C)C)O2)O1 |
| InChI | InChI=1S/C30H60O6Si2/c1-14-24(31)15-25-16-26(32-11)18-30(34-25)19-27(36-37(12,13)29(8,9)10)17-28(35-30)20-33-38(21(2)3,22(4)5)23(6)7/h21-23,25-28H,14-20H2,1-13H3/t25-,26+,27+,28-,30-/m1/s1 |
| InChIKey | FTHHNLAFNSFACM-VABWOUDCSA-N |
| XLogP | 8.01 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.98 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|