C28H58O6Si3 — CID 23631140
1-[(2S,3S,4R,5S,6S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-methyloxan-2-yl]butane-2,3-dione (PubChem CID 23631140) has the molecular formula C28H58O6Si3 and a molecular weight of 575.02 g/mol. Its IUPAC name is 1-[(2S,3S,4R,5S,6S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-methyloxan-2-yl]butane-2,3-dione.
| Compound Name | 1-[(2S,3S,4R,5S,6S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-methyloxan-2-yl]butane-2,3-dione |
|---|---|
| PubChem CID | 23631140 |
| Molecular Formula | C28H58O6Si3 |
| Molecular Weight | 575.02 g/mol |
| Exact Mass | 574.35 |
| IUPAC Name | 1-[(2S,3S,4R,5S,6S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-methyloxan-2-yl]butane-2,3-dione |
| SMILES | CC(=O)C(=O)C[C@@H]1O[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H58O6Si3/c1-19(29)21(30)18-22-24(33-36(14,15)27(6,7)8)25(34-37(16,17)28(9,10)11)23(20(2)31-22)32-35(12,13)26(3,4)5/h20,22-25H,18H2,1-17H3/t20-,22-,23-,24-,25+/m0/s1 |
| InChIKey | ZATVWBMKHDDYGU-XFASLETNSA-N |
| XLogP | 7.49 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.02 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|