C31H68O6Si4 — CID 134833656
(2R,5S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]oxane-2-carbaldehyde (PubChem CID 134833656) has the molecular formula C31H68O6Si4 and a molecular weight of 649.22 g/mol. Its IUPAC name is (2R,5S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]oxane-2-carbaldehyde.
| Compound Name | (2R,5S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]oxane-2-carbaldehyde |
|---|---|
| PubChem CID | 134833656 |
| Molecular Formula | C31H68O6Si4 |
| Molecular Weight | 649.22 g/mol |
| Exact Mass | 648.41 |
| IUPAC Name | (2R,5S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]oxane-2-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OCC1O[C@@H](C=O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H68O6Si4/c1-28(2,3)38(13,14)33-22-24-26(36-40(17,18)30(7,8)9)27(37-41(19,20)31(10,11)12)25(23(21-32)34-24)35-39(15,16)29(4,5)6/h21,23-27H,22H2,1-20H3/t23-,24?,25?,26-,27?/m0/s1 |
| InChIKey | FZKXTYTVEOWFOI-XQTAVERSSA-N |
| XLogP | 9.15 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.22 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|