C33H72O6Si4 — CID 162419872
(2R,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(1S,3R)-1,3,4-tris[[tert-butyl(dimethyl)silyl]oxy]butyl]oxolane-2-carbaldehyde (PubChem CID 162419872) has the molecular formula C33H72O6Si4 and a molecular weight of 677.28 g/mol. Its IUPAC name is (2R,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(1S,3R)-1,3,4-tris[[tert-butyl(dimethyl)silyl]oxy]butyl]oxolane-2-carbaldehyde.
| Compound Name | (2R,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(1S,3R)-1,3,4-tris[[tert-butyl(dimethyl)silyl]oxy]butyl]oxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 162419872 |
| Molecular Formula | C33H72O6Si4 |
| Molecular Weight | 677.28 g/mol |
| Exact Mass | 676.44 |
| IUPAC Name | (2R,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(1S,3R)-1,3,4-tris[[tert-butyl(dimethyl)silyl]oxy]butyl]oxolane-2-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C=O)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H72O6Si4/c1-30(2,3)40(13,14)35-24-25(37-41(15,16)31(4,5)6)21-27(38-42(17,18)32(7,8)9)26-22-28(29(23-34)36-26)39-43(19,20)33(10,11)12/h23,25-29H,21-22,24H2,1-20H3/t25-,26+,27+,28+,29+/m1/s1 |
| InChIKey | BYPPAGCQODPEIA-QZLCNWOESA-N |
| XLogP | 9.93 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.28 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|