C29H60O6Si — CID 89338434
(3S,4S,5S,6R)-3,4,5,7-tetrabutoxy-6-triethylsilyloxyheptanal (PubChem CID 89338434) has the molecular formula C29H60O6Si and a molecular weight of 532.88 g/mol. Its IUPAC name is (3S,4S,5S,6R)-3,4,5,7-tetrabutoxy-6-triethylsilyloxyheptanal.
| Compound Name | (3S,4S,5S,6R)-3,4,5,7-tetrabutoxy-6-triethylsilyloxyheptanal |
|---|---|
| PubChem CID | 89338434 |
| Molecular Formula | C29H60O6Si |
| Molecular Weight | 532.88 g/mol |
| Exact Mass | 532.42 |
| IUPAC Name | (3S,4S,5S,6R)-3,4,5,7-tetrabutoxy-6-triethylsilyloxyheptanal |
| SMILES | CCCCOC[C@@H](O[Si](CC)(CC)CC)[C@@H](OCCCC)[C@@H](OCCCC)[C@H](CC=O)OCCCC |
| InChI | InChI=1S/C29H60O6Si/c1-8-15-21-31-25-27(35-36(12-5,13-6)14-7)29(34-24-18-11-4)28(33-23-17-10-3)26(19-20-30)32-22-16-9-2/h20,26-29H,8-19,21-25H2,1-7H3/t26-,27+,28-,29+/m0/s1 |
| InChIKey | YDYQOHFNKCNLPX-ICYKMPLBSA-N |
| XLogP | 7.34 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.88 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|