About 2-(1,2-dibutoxyethoxy)ethyl formate
2-(1,2-dibutoxyethoxy)ethyl formate (PubChem CID 57319136) has the molecular formula C13H26O5
and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-(1,2-dibutoxyethoxy)ethyl formate.
Molecular Properties
| Compound Name | 2-(1,2-dibutoxyethoxy)ethyl formate |
| PubChem CID | 57319136 |
| Molecular Formula | C13H26O5 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 2-(1,2-dibutoxyethoxy)ethyl formate |
| SMILES | CCCCOCC(OCCCC)OCCOC=O |
| InChI | InChI=1S/C13H26O5/c1-3-5-7-15-11-13(17-8-6-4-2)18-10-9-16-12-14/h12-13H,3-11H2,1-2H3 |
| InChIKey | ZKPBTIJLUUXWPD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,2-dibutoxyethoxy)ethyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2-dibutoxyethoxy)ethyl formate?
The IUPAC name of 2-(1,2-dibutoxyethoxy)ethyl formate (CID 57319136) is 2-(1,2-dibutoxyethoxy)ethyl formate.
What is the SMILES notation for 2-(1,2-dibutoxyethoxy)ethyl formate?
The canonical SMILES for 2-(1,2-dibutoxyethoxy)ethyl formate is CCCCOCC(OCCCC)OCCOC=O.
What is the InChIKey of 2-(1,2-dibutoxyethoxy)ethyl formate?
The InChIKey is ZKPBTIJLUUXWPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O5/c1-3-5-7-15-11-13(17-8-6-4-2)18-10-9-16-12-14/h12-13H,3-11H2,1-2H3.
What are the key properties of 2-(1,2-dibutoxyethoxy)ethyl formate?
2-(1,2-dibutoxyethoxy)ethyl formate has a molecular weight of 262.35 g/mol, XLogP of 2.14, 14 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2-dibutoxyethoxy)ethyl formate is sourced from PubChem (CID 57319136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).