C26H50O6Si2 — CID 10864188
1-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]-4-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]butane-2,3-dione (PubChem CID 10864188) has the molecular formula C26H50O6Si2 and a molecular weight of 514.85 g/mol. Its IUPAC name is 1-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]-4-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]butane-2,3-dione.
| Compound Name | 1-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]-4-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]butane-2,3-dione |
|---|---|
| PubChem CID | 10864188 |
| Molecular Formula | C26H50O6Si2 |
| Molecular Weight | 514.85 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | 1-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]-4-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]butane-2,3-dione |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCCO[C@@H]1CC(=O)C(=O)C[C@@H]1OCCC[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H50O6Si2/c1-25(2,3)33(7,8)31-21-13-11-15-29-23(21)17-19(27)20(28)18-24-22(14-12-16-30-24)32-34(9,10)26(4,5)6/h21-24H,11-18H2,1-10H3/t21-,22+,23+,24- |
| InChIKey | NJGGSUQJJIHLBD-NVPYSNMXSA-N |
| XLogP | 6.04 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.85 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|