C14H28O3Si — CID 11737367
1-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]propan-2-one (PubChem CID 11737367) has the molecular formula C14H28O3Si and a molecular weight of 272.46 g/mol. Its IUPAC name is 1-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]propan-2-one.
| Compound Name | 1-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 11737367 |
| Molecular Formula | C14H28O3Si |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 1-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]propan-2-one |
| SMILES | CC(=O)C[C@H]1OCCC[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H28O3Si/c1-11(15)10-13-12(8-7-9-16-13)17-18(5,6)14(2,3)4/h12-13H,7-10H2,1-6H3/t12-,13+/m0/s1 |
| InChIKey | OZILZDYCGVTKIX-QWHCGFSZSA-N |
| XLogP | 3.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|