C27H54O6Si2 — CID 10885954
1-[(2R,4S,6R,8S,10S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-10-methoxy-1,7-dioxaspiro[5.5]undecan-8-yl]butan-2-one (PubChem CID 10885954) has the molecular formula C27H54O6Si2 and a molecular weight of 530.90 g/mol. Its IUPAC name is 1-[(2R,4S,6R,8S,10S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-10-methoxy-1,7-dioxaspiro[5.5]undecan-8-yl]butan-2-one.
| Compound Name | 1-[(2R,4S,6R,8S,10S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-10-methoxy-1,7-dioxaspiro[5.5]undecan-8-yl]butan-2-one |
|---|---|
| PubChem CID | 10885954 |
| Molecular Formula | C27H54O6Si2 |
| Molecular Weight | 530.90 g/mol |
| Exact Mass | 530.35 |
| IUPAC Name | 1-[(2R,4S,6R,8S,10S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-10-methoxy-1,7-dioxaspiro[5.5]undecan-8-yl]butan-2-one |
| SMILES | CCC(=O)C[C@@H]1C[C@H](OC)C[C@@]2(C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](CO[Si](C)(C)C(C)(C)C)O2)O1 |
| InChI | InChI=1S/C27H54O6Si2/c1-13-20(28)14-21-15-22(29-8)17-27(31-21)18-23(33-35(11,12)26(5,6)7)16-24(32-27)19-30-34(9,10)25(2,3)4/h21-24H,13-19H2,1-12H3/t21-,22+,23+,24-,27-/m1/s1 |
| InChIKey | HDCWJVGZDDBJTL-CHYHEQJZSA-N |
| XLogP | 6.84 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.90 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|