C26H56O5Si3 — CID 171475509
1-[(2S,3S,4S,5R)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]oxan-2-yl]propan-2-one (PubChem CID 171475509) has the molecular formula C26H56O5Si3 and a molecular weight of 532.99 g/mol. Its IUPAC name is 1-[(2S,3S,4S,5R)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]oxan-2-yl]propan-2-one.
| Compound Name | 1-[(2S,3S,4S,5R)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]oxan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 171475509 |
| Molecular Formula | C26H56O5Si3 |
| Molecular Weight | 532.99 g/mol |
| Exact Mass | 532.34 |
| IUPAC Name | 1-[(2S,3S,4S,5R)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]oxan-2-yl]propan-2-one |
| SMILES | CC(=O)C[C@@H]1OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H56O5Si3/c1-19(27)17-20-22(30-33(13,14)25(5,6)7)23(31-34(15,16)26(8,9)10)21(18-28-20)29-32(11,12)24(2,3)4/h20-23H,17-18H2,1-16H3/t20-,21+,22-,23-/m0/s1 |
| InChIKey | QZBSZQFRLCZEGZ-BJESRGMDSA-N |
| XLogP | 7.54 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.99 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|