C16H32O5Si2 — CID 134922982
2-[(2R,3R,4R,4aS,8aS)-3,4-bis(trimethylsilyloxy)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]acetaldehyde (PubChem CID 134922982) has the molecular formula C16H32O5Si2 and a molecular weight of 360.60 g/mol. Its IUPAC name is 2-[(2R,3R,4R,4aS,8aS)-3,4-bis(trimethylsilyloxy)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]acetaldehyde.
| Compound Name | 2-[(2R,3R,4R,4aS,8aS)-3,4-bis(trimethylsilyloxy)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 134922982 |
| Molecular Formula | C16H32O5Si2 |
| Molecular Weight | 360.60 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 2-[(2R,3R,4R,4aS,8aS)-3,4-bis(trimethylsilyloxy)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]acetaldehyde |
| SMILES | C[Si](C)(C)O[C@@H]1[C@H]2OCCC[C@@H]2O[C@H](CC=O)[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C16H32O5Si2/c1-22(2,3)20-15-13(9-10-17)19-12-8-7-11-18-14(12)16(15)21-23(4,5)6/h10,12-16H,7-9,11H2,1-6H3/t12-,13+,14-,15+,16+/m0/s1 |
| InChIKey | ZUMNESSOHOCIAR-ZVDSWSACSA-N |
| XLogP | 2.96 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.60 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|