C32H64O7Si3 — CID 10627966
2-[(1S,3R,4S,5R,7R,8S,9S,11R)-11-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4,8-bis(triethylsilyloxy)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-5-yl]acetaldehyde (PubChem CID 10627966) has the molecular formula C32H64O7Si3 and a molecular weight of 645.12 g/mol. Its IUPAC name is 2-[(1S,3R,4S,5R,7R,8S,9S,11R)-11-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4,8-bis(triethylsilyloxy)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-5-yl]acetaldehyde.
| Compound Name | 2-[(1S,3R,4S,5R,7R,8S,9S,11R)-11-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4,8-bis(triethylsilyloxy)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-5-yl]acetaldehyde |
|---|---|
| PubChem CID | 10627966 |
| Molecular Formula | C32H64O7Si3 |
| Molecular Weight | 645.12 g/mol |
| Exact Mass | 644.40 |
| IUPAC Name | 2-[(1S,3R,4S,5R,7R,8S,9S,11R)-11-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4,8-bis(triethylsilyloxy)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-5-yl]acetaldehyde |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@@H]2O[C@H](CC=O)[C@H](O[Si](CC)(CC)CC)[C@@H]2O[C@H]2CC[C@H](CCO[Si](C)(C)C(C)(C)C)O[C@H]12 |
| InChI | InChI=1S/C32H64O7Si3/c1-12-41(13-2,14-3)38-28-26(20-22-33)37-30-29(28)36-25-19-18-24(21-23-34-40(10,11)32(7,8)9)35-27(25)31(30)39-42(15-4,16-5)17-6/h22,24-31H,12-21,23H2,1-11H3/t24-,25+,26-,27+,28+,29+,30-,31+/m1/s1 |
| InChIKey | JEZQGCFWIHFOQG-YWPDGNGOSA-N |
| XLogP | 7.85 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.12 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|