C24H42O8Si — CID 10863860
methyl 2-[(1S,2S,6R,7R,9S,12R)-7-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-oxoethyl]-4,4-diethyl-3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecan-12-yl]acetate (PubChem CID 10863860) has the molecular formula C24H42O8Si and a molecular weight of 486.68 g/mol. Its IUPAC name is methyl 2-[(1S,2S,6R,7R,9S,12R)-7-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-oxoethyl]-4,4-diethyl-3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecan-12-yl]acetate.
| Compound Name | methyl 2-[(1S,2S,6R,7R,9S,12R)-7-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-oxoethyl]-4,4-diethyl-3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecan-12-yl]acetate |
|---|---|
| PubChem CID | 10863860 |
| Molecular Formula | C24H42O8Si |
| Molecular Weight | 486.68 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | methyl 2-[(1S,2S,6R,7R,9S,12R)-7-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-oxoethyl]-4,4-diethyl-3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecan-12-yl]acetate |
| SMILES | CCC1(CC)O[C@@H]2[C@H](O1)[C@H]([C@H](C=O)O[Si](C)(C)C(C)(C)C)O[C@H]1CC[C@H](CC(=O)OC)O[C@H]21 |
| InChI | InChI=1S/C24H42O8Si/c1-9-24(10-2)30-21-19-16(12-11-15(28-19)13-18(26)27-6)29-20(22(21)31-24)17(14-25)32-33(7,8)23(3,4)5/h14-17,19-22H,9-13H2,1-8H3/t15-,16+,17+,19+,20+,21+,22-/m1/s1 |
| InChIKey | QSSBKKHGXBDHRT-CVLIFIHMSA-N |
| XLogP | 3.75 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.68 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|