C26H44O9SSi — CID 11656985
methyl 2-[(1S,2S,6R,7R,9S,12R)-7-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2-sulfanylidene-1,3-dioxolan-4-yl]methyl]-4,4-diethyl-3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecan-12-yl]acetate (PubChem CID 11656985) has the molecular formula C26H44O9SSi and a molecular weight of 560.78 g/mol. Its IUPAC name is methyl 2-[(1S,2S,6R,7R,9S,12R)-7-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2-sulfanylidene-1,3-dioxolan-4-yl]methyl]-4,4-diethyl-3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecan-12-yl]acetate.
| Compound Name | methyl 2-[(1S,2S,6R,7R,9S,12R)-7-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2-sulfanylidene-1,3-dioxolan-4-yl]methyl]-4,4-diethyl-3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecan-12-yl]acetate |
|---|---|
| PubChem CID | 11656985 |
| Molecular Formula | C26H44O9SSi |
| Molecular Weight | 560.78 g/mol |
| Exact Mass | 560.25 |
| IUPAC Name | methyl 2-[(1S,2S,6R,7R,9S,12R)-7-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2-sulfanylidene-1,3-dioxolan-4-yl]methyl]-4,4-diethyl-3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecan-12-yl]acetate |
| SMILES | CCC1(CC)O[C@H]2[C@@H](O1)[C@H]1O[C@@H](CC(=O)OC)CC[C@@H]1O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1COC(=S)O1 |
| InChI | InChI=1S/C26H44O9SSi/c1-9-26(10-2)33-22-19-16(12-11-15(30-19)13-18(27)28-6)31-21(23(22)34-26)20(17-14-29-24(36)32-17)35-37(7,8)25(3,4)5/h15-17,19-23H,9-14H2,1-8H3/t15-,16+,17-,19+,20+,21+,22+,23-/m1/s1 |
| InChIKey | RAWPYUPMZFAADA-BQOQVLNTSA-N |
| XLogP | 4.26 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.78 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|