C19H30O8 — CID 162773786
methyl 2-[(1S,2S,6R,7S,9S,12R)-7-(2,2-dimethyl-1,3-dioxolan-4-yl)-4,4-dimethyl-3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecan-12-yl]acetate (PubChem CID 162773786) has the molecular formula C19H30O8 and a molecular weight of 386.44 g/mol. Its IUPAC name is methyl 2-[(1S,2S,6R,7S,9S,12R)-7-(2,2-dimethyl-1,3-dioxolan-4-yl)-4,4-dimethyl-3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecan-12-yl]acetate.
| Compound Name | methyl 2-[(1S,2S,6R,7S,9S,12R)-7-(2,2-dimethyl-1,3-dioxolan-4-yl)-4,4-dimethyl-3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecan-12-yl]acetate |
|---|---|
| PubChem CID | 162773786 |
| Molecular Formula | C19H30O8 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | methyl 2-[(1S,2S,6R,7S,9S,12R)-7-(2,2-dimethyl-1,3-dioxolan-4-yl)-4,4-dimethyl-3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecan-12-yl]acetate |
| SMILES | COC(=O)C[C@H]1CC[C@@H]2O[C@@H](C3COC(C)(C)O3)[C@H]3OC(C)(C)O[C@H]3[C@H]2O1 |
| InChI | InChI=1S/C19H30O8/c1-18(2)22-9-12(25-18)15-17-16(26-19(3,4)27-17)14-11(24-15)7-6-10(23-14)8-13(20)21-5/h10-12,14-17H,6-9H2,1-5H3/t10-,11+,12?,14+,15+,16+,17-/m1/s1 |
| InChIKey | BNKGQZZEUCRFPB-GVSVHHRTSA-N |
| XLogP | 1.54 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |