C30H54O9Si — CID 10769663
methyl 2-[(1S,2S,6R,7R,9S,12R)-7-[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]methyl]-4,4-diethyl-3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecan-12-yl]acetate (PubChem CID 10769663) has the molecular formula C30H54O9Si and a molecular weight of 586.84 g/mol. Its IUPAC name is methyl 2-[(1S,2S,6R,7R,9S,12R)-7-[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]methyl]-4,4-diethyl-3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecan-12-yl]acetate.
| Compound Name | methyl 2-[(1S,2S,6R,7R,9S,12R)-7-[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]methyl]-4,4-diethyl-3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecan-12-yl]acetate |
|---|---|
| PubChem CID | 10769663 |
| Molecular Formula | C30H54O9Si |
| Molecular Weight | 586.84 g/mol |
| Exact Mass | 586.35 |
| IUPAC Name | methyl 2-[(1S,2S,6R,7R,9S,12R)-7-[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]methyl]-4,4-diethyl-3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecan-12-yl]acetate |
| SMILES | CCC1(CC)O[C@H]2[C@@H](O1)[C@H]1O[C@@H](CC(=O)OC)CC[C@@H]1O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1COC(CC)(CC)O1 |
| InChI | InChI=1S/C30H54O9Si/c1-11-29(12-2)33-18-21(36-29)24(39-40(9,10)28(5,6)7)25-27-26(37-30(13-3,14-4)38-27)23-20(35-25)16-15-19(34-23)17-22(31)32-8/h19-21,23-27H,11-18H2,1-10H3/t19-,20+,21-,23+,24-,25+,26+,27-/m1/s1 |
| InChIKey | BXXHZMBTJPAWNH-YPMDPXDNSA-N |
| XLogP | 5.49 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.84 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|