C26H48O8Si2 — CID 11410183
methyl 2-[(1S,3R,4R,5S,7R,8S,9S,11R)-5-formyl-4,8-bis(triethylsilyloxy)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-11-yl]acetate (PubChem CID 11410183) has the molecular formula C26H48O8Si2 and a molecular weight of 544.83 g/mol. Its IUPAC name is methyl 2-[(1S,3R,4R,5S,7R,8S,9S,11R)-5-formyl-4,8-bis(triethylsilyloxy)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-11-yl]acetate.
| Compound Name | methyl 2-[(1S,3R,4R,5S,7R,8S,9S,11R)-5-formyl-4,8-bis(triethylsilyloxy)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-11-yl]acetate |
|---|---|
| PubChem CID | 11410183 |
| Molecular Formula | C26H48O8Si2 |
| Molecular Weight | 544.83 g/mol |
| Exact Mass | 544.29 |
| IUPAC Name | methyl 2-[(1S,3R,4R,5S,7R,8S,9S,11R)-5-formyl-4,8-bis(triethylsilyloxy)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-11-yl]acetate |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@@H]2O[C@H](C=O)[C@H](O[Si](CC)(CC)CC)[C@@H]2O[C@H]2CC[C@H](CC(=O)OC)O[C@H]12 |
| InChI | InChI=1S/C26H48O8Si2/c1-8-35(9-2,10-3)33-23-20(17-27)32-25-24(23)31-19-15-14-18(16-21(28)29-7)30-22(19)26(25)34-36(11-4,12-5)13-6/h17-20,22-26H,8-16H2,1-7H3/t18-,19+,20-,22+,23+,24+,25-,26+/m1/s1 |
| InChIKey | DAMDNIPYZJJANP-ITKWXHAOSA-N |
| XLogP | 4.61 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.83 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|