C32H64O8Si3 — CID 10770639
2-[(1S,3R,4S,5R,7R,8S,9S,11R)-11-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4,8-bis(triethylsilyloxy)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-5-yl]acetic acid (PubChem CID 10770639) has the molecular formula C32H64O8Si3 and a molecular weight of 661.11 g/mol. Its IUPAC name is 2-[(1S,3R,4S,5R,7R,8S,9S,11R)-11-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4,8-bis(triethylsilyloxy)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-5-yl]acetic acid.
| Compound Name | 2-[(1S,3R,4S,5R,7R,8S,9S,11R)-11-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4,8-bis(triethylsilyloxy)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-5-yl]acetic acid |
|---|---|
| PubChem CID | 10770639 |
| Molecular Formula | C32H64O8Si3 |
| Molecular Weight | 661.11 g/mol |
| Exact Mass | 660.39 |
| IUPAC Name | 2-[(1S,3R,4S,5R,7R,8S,9S,11R)-11-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4,8-bis(triethylsilyloxy)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-5-yl]acetic acid |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@@H]2O[C@H](CC(=O)O)[C@H](O[Si](CC)(CC)CC)[C@@H]2O[C@H]2CC[C@H](CCO[Si](C)(C)C(C)(C)C)O[C@H]12 |
| InChI | InChI=1S/C32H64O8Si3/c1-12-42(13-2,14-3)39-28-25(22-26(33)34)38-30-29(28)37-24-19-18-23(20-21-35-41(10,11)32(7,8)9)36-27(24)31(30)40-43(15-4,16-5)17-6/h23-25,27-31H,12-22H2,1-11H3,(H,33,34)/t23-,24+,25-,27+,28+,29+,30-,31+/m1/s1 |
| InChIKey | QRCONONFJSFRGJ-NIWRROQBSA-N |
| XLogP | 7.74 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.11 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|