C26H50O7Si2 — CID 24879813
methyl 2-[(2S,3R,4S,4aS,6R,8aS)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(1S)-1-hydroxyprop-2-enyl]-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-6-yl]acetate (PubChem CID 24879813) has the molecular formula C26H50O7Si2 and a molecular weight of 530.85 g/mol. Its IUPAC name is methyl 2-[(2S,3R,4S,4aS,6R,8aS)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(1S)-1-hydroxyprop-2-enyl]-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-6-yl]acetate.
| Compound Name | methyl 2-[(2S,3R,4S,4aS,6R,8aS)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(1S)-1-hydroxyprop-2-enyl]-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-6-yl]acetate |
|---|---|
| PubChem CID | 24879813 |
| Molecular Formula | C26H50O7Si2 |
| Molecular Weight | 530.85 g/mol |
| Exact Mass | 530.31 |
| IUPAC Name | methyl 2-[(2S,3R,4S,4aS,6R,8aS)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(1S)-1-hydroxyprop-2-enyl]-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-6-yl]acetate |
| SMILES | C=C[C@H](O)[C@@H]1O[C@H]2CC[C@H](CC(=O)OC)O[C@@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H50O7Si2/c1-13-18(27)21-23(32-34(9,10)25(2,3)4)24(33-35(11,12)26(5,6)7)22-19(31-21)15-14-17(30-22)16-20(28)29-8/h13,17-19,21-24,27H,1,14-16H2,2-12H3/t17-,18+,19+,21+,22+,23-,24+/m1/s1 |
| InChIKey | VYPSEPGAMPHKJM-SEPJHCTASA-N |
| XLogP | 5.19 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.85 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|