C20H30O7 — CID 23281224
methyl 2-[(1S,2S,4R,7S,9R,10R,12S,14R,16R)-12-pentyl-3,8,11,15,17-pentaoxapentacyclo[10.4.1.02,7.09,16.010,14]heptadecan-4-yl]acetate (PubChem CID 23281224) has the molecular formula C20H30O7 and a molecular weight of 382.45 g/mol. Its IUPAC name is methyl 2-[(1S,2S,4R,7S,9R,10R,12S,14R,16R)-12-pentyl-3,8,11,15,17-pentaoxapentacyclo[10.4.1.02,7.09,16.010,14]heptadecan-4-yl]acetate.
| Compound Name | methyl 2-[(1S,2S,4R,7S,9R,10R,12S,14R,16R)-12-pentyl-3,8,11,15,17-pentaoxapentacyclo[10.4.1.02,7.09,16.010,14]heptadecan-4-yl]acetate |
|---|---|
| PubChem CID | 23281224 |
| Molecular Formula | C20H30O7 |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | methyl 2-[(1S,2S,4R,7S,9R,10R,12S,14R,16R)-12-pentyl-3,8,11,15,17-pentaoxapentacyclo[10.4.1.02,7.09,16.010,14]heptadecan-4-yl]acetate |
| SMILES | CCCCC[C@@]12C[C@H]3O[C@H]4[C@@H](O1)[C@H]1O[C@@H](CC(=O)OC)CC[C@@H]1O[C@H]4[C@@H]3O2 |
| InChI | InChI=1S/C20H30O7/c1-3-4-5-8-20-10-13-16(26-20)17-18(25-13)19(27-20)15-12(24-17)7-6-11(23-15)9-14(21)22-2/h11-13,15-19H,3-10H2,1-2H3/t11-,12+,13-,15+,16-,17+,18-,19+,20+/m1/s1 |
| InChIKey | RYEDUVMYXOGGJC-PVBCVEJASA-N |
| XLogP | 2.10 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|