C19H28O6 — CID 135242645
methyl 2-[(3R,7S,8R,10S,13R)-spiro[4,6,9,14-tetraoxatetracyclo[6.6.1.01,10.03,7]pentadecane-5,1'-cyclohexane]-13-yl]acetate (PubChem CID 135242645) has the molecular formula C19H28O6 and a molecular weight of 352.43 g/mol. Its IUPAC name is methyl 2-[(3R,7S,8R,10S,13R)-spiro[4,6,9,14-tetraoxatetracyclo[6.6.1.01,10.03,7]pentadecane-5,1'-cyclohexane]-13-yl]acetate.
| Compound Name | methyl 2-[(3R,7S,8R,10S,13R)-spiro[4,6,9,14-tetraoxatetracyclo[6.6.1.01,10.03,7]pentadecane-5,1'-cyclohexane]-13-yl]acetate |
|---|---|
| PubChem CID | 135242645 |
| Molecular Formula | C19H28O6 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | methyl 2-[(3R,7S,8R,10S,13R)-spiro[4,6,9,14-tetraoxatetracyclo[6.6.1.01,10.03,7]pentadecane-5,1'-cyclohexane]-13-yl]acetate |
| SMILES | COC(=O)C[C@H]1CC[C@@H]2O[C@@H]3CC2(C[C@H]2OC4(CCCCC4)O[C@@H]32)O1 |
| InChI | InChI=1S/C19H28O6/c1-21-16(20)9-12-5-6-15-18(23-12)10-13(22-15)17-14(11-18)24-19(25-17)7-3-2-4-8-19/h12-15,17H,2-11H2,1H3/t12-,13-,14-,15+,17+,18?/m1/s1 |
| InChIKey | RFKYPOUXFCKRLR-QVMWIFEESA-N |
| XLogP | 2.47 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |