C25H36O9 — CID 157377235
methyl 2-[(1R,3R,6S,8R,9R,11R)-2,7,10-trioxatetracyclo[6.4.1.01,6.09,11]tridecan-3-yl]acetate;2-[(1R,3R,6S,8R,9R,11R)-2,7,10-trioxatetracyclo[6.4.1.01,6.09,11]tridecan-3-yl]ethanol (PubChem CID 157377235) has the molecular formula C25H36O9 and a molecular weight of 480.55 g/mol. Its IUPAC name is methyl 2-[(1R,3R,6S,8R,9R,11R)-2,7,10-trioxatetracyclo[6.4.1.01,6.09,11]tridecan-3-yl]acetate;2-[(1R,3R,6S,8R,9R,11R)-2,7,10-trioxatetracyclo[6.4.1.01,6.09,11]tridecan-3-yl]ethanol.
| Compound Name | methyl 2-[(1R,3R,6S,8R,9R,11R)-2,7,10-trioxatetracyclo[6.4.1.01,6.09,11]tridecan-3-yl]acetate;2-[(1R,3R,6S,8R,9R,11R)-2,7,10-trioxatetracyclo[6.4.1.01,6.09,11]tridecan-3-yl]ethanol |
|---|---|
| PubChem CID | 157377235 |
| Molecular Formula | C25H36O9 |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | methyl 2-[(1R,3R,6S,8R,9R,11R)-2,7,10-trioxatetracyclo[6.4.1.01,6.09,11]tridecan-3-yl]acetate;2-[(1R,3R,6S,8R,9R,11R)-2,7,10-trioxatetracyclo[6.4.1.01,6.09,11]tridecan-3-yl]ethanol |
| SMILES | COC(=O)C[C@H]1CC[C@@H]2O[C@@H]3C[C@]2(C[C@H]2O[C@H]23)O1.OCC[C@H]1CC[C@@H]2O[C@@H]3C[C@]2(C[C@H]2O[C@H]23)O1 |
| InChI | InChI=1S/C13H18O5.C12H18O4/c1-15-11(14)4-7-2-3-10-13(18-7)5-8(16-10)12-9(6-13)17-12;13-4-3-7-1-2-10-12(16-7)5-8(14-10)11-9(6-12)15-11/h7-10,12H,2-6H2,1H3;7-11,13H,1-6H2/t7-,8-,9-,10+,12+,13-;7-,8-,9-,10+,11+,12-/m11/s1 |
| InChIKey | BKLPHIDFHWVPKC-UEYNBJHGSA-N |
| XLogP | 1.41 |
| TPSA | 108.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|