2-(2,7-dioxatricyclo[6.3.1.01,6]dodecan-3-yl)ethanol;molecular hydrogen

C12H22O3 — CID 143150642

IUPAC2-(2,7-dioxatricyclo[6.3.1.01,6]dodecan-3-yl)ethanol;molecular hydrogen
SMILESOCCC1CCC2OC3CCCC2(C3)O1.[H][H]
InChIInChI=1S/C12H20O3.H2/c13-7-5-9-3-4-11-12(15-9)6-1-2-10(8-12)14-11;/h9-11,13H,1-8H2;1H
InChIKeyIOPOSGPQSMLLEY-UHFFFAOYSA-N
MW214.30 g/mol
LogP1.87
Rot. Bonds2

About 2-(2,7-dioxatricyclo[6.3.1.01,6]dodecan-3-yl)ethanol;molecular hydrogen

2-(2,7-dioxatricyclo[6.3.1.01,6]dodecan-3-yl)ethanol;molecular hydrogen (PubChem CID 143150642) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is 2-(2,7-dioxatricyclo[6.3.1.01,6]dodecan-3-yl)ethanol;molecular hydrogen.

Molecular Properties

Compound Name2-(2,7-dioxatricyclo[6.3.1.01,6]dodecan-3-yl)ethanol;molecular hydrogen
PubChem CID143150642
Molecular FormulaC12H22O3
Molecular Weight214.30 g/mol
Exact Mass214.16
IUPAC Name2-(2,7-dioxatricyclo[6.3.1.01,6]dodecan-3-yl)ethanol;molecular hydrogen
SMILESOCCC1CCC2OC3CCCC2(C3)O1.[H][H]
InChIInChI=1S/C12H20O3.H2/c13-7-5-9-3-4-11-12(15-9)6-1-2-10(8-12)14-11;/h9-11,13H,1-8H2;1H
InChIKeyIOPOSGPQSMLLEY-UHFFFAOYSA-N
XLogP1.87
TPSA38.69 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.30
LogP ≤ 51.87
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(2,7-dioxatricyclo[6.3.1.01,6]dodecan-3-yl)ethanol;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,7-dioxatricyclo[6.3.1.01,6]dodecan-3-yl)ethanol;molecular hydrogen?
The IUPAC name of 2-(2,7-dioxatricyclo[6.3.1.01,6]dodecan-3-yl)ethanol;molecular hydrogen (CID 143150642) is 2-(2,7-dioxatricyclo[6.3.1.01,6]dodecan-3-yl)ethanol;molecular hydrogen.
What is the SMILES notation for 2-(2,7-dioxatricyclo[6.3.1.01,6]dodecan-3-yl)ethanol;molecular hydrogen?
The canonical SMILES for 2-(2,7-dioxatricyclo[6.3.1.01,6]dodecan-3-yl)ethanol;molecular hydrogen is OCCC1CCC2OC3CCCC2(C3)O1.[H][H].
What is the InChIKey of 2-(2,7-dioxatricyclo[6.3.1.01,6]dodecan-3-yl)ethanol;molecular hydrogen?
The InChIKey is IOPOSGPQSMLLEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O3.H2/c13-7-5-9-3-4-11-12(15-9)6-1-2-10(8-12)14-11;/h9-11,13H,1-8H2;1H.
What are the key properties of 2-(2,7-dioxatricyclo[6.3.1.01,6]dodecan-3-yl)ethanol;molecular hydrogen?
2-(2,7-dioxatricyclo[6.3.1.01,6]dodecan-3-yl)ethanol;molecular hydrogen has a molecular weight of 214.30 g/mol, XLogP of 1.87, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,7-dioxatricyclo[6.3.1.01,6]dodecan-3-yl)ethanol;molecular hydrogen is sourced from PubChem (CID 143150642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).