C19H27NO4 — CID 123799866
(1R,3R,7S,8R,10S,13R)-13-(2-isocyanoethyl)spiro[4,6,9,14-tetraoxatetracyclo[6.6.1.01,10.03,7]pentadecane-5,1'-cyclohexane] (PubChem CID 123799866) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is (1R,3R,7S,8R,10S,13R)-13-(2-isocyanoethyl)spiro[4,6,9,14-tetraoxatetracyclo[6.6.1.01,10.03,7]pentadecane-5,1'-cyclohexane].
| Compound Name | (1R,3R,7S,8R,10S,13R)-13-(2-isocyanoethyl)spiro[4,6,9,14-tetraoxatetracyclo[6.6.1.01,10.03,7]pentadecane-5,1'-cyclohexane] |
|---|---|
| PubChem CID | 123799866 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | (1R,3R,7S,8R,10S,13R)-13-(2-isocyanoethyl)spiro[4,6,9,14-tetraoxatetracyclo[6.6.1.01,10.03,7]pentadecane-5,1'-cyclohexane] |
| SMILES | [C-]#[N+]CC[C@H]1CC[C@@H]2O[C@@H]3C[C@]2(C[C@H]2OC4(CCCCC4)O[C@@H]32)O1 |
| InChI | InChI=1S/C19H27NO4/c1-20-10-7-13-5-6-16-18(22-13)11-14(21-16)17-15(12-18)23-19(24-17)8-3-2-4-9-19/h13-17H,2-12H2/t13-,14-,15-,16+,17+,18-/m1/s1 |
| InChIKey | NVDORBBTEXNFLT-BLONOQDTSA-N |
| XLogP | 3.22 |
| TPSA | 41.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|