C12H20O5 — CID 10354459
(3aS,4R,6R,7aR)-6-(hydroxymethyl)spiro[4,5,7,7a-tetrahydro-3aH-1,3-benzodioxole-2,1'-cyclopentane]-4,6-diol (PubChem CID 10354459) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is (3aS,4R,6R,7aR)-6-(hydroxymethyl)spiro[4,5,7,7a-tetrahydro-3aH-1,3-benzodioxole-2,1'-cyclopentane]-4,6-diol.
| Compound Name | (3aS,4R,6R,7aR)-6-(hydroxymethyl)spiro[4,5,7,7a-tetrahydro-3aH-1,3-benzodioxole-2,1'-cyclopentane]-4,6-diol |
|---|---|
| PubChem CID | 10354459 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | (3aS,4R,6R,7aR)-6-(hydroxymethyl)spiro[4,5,7,7a-tetrahydro-3aH-1,3-benzodioxole-2,1'-cyclopentane]-4,6-diol |
| SMILES | OC[C@@]1(O)C[C@@H](O)[C@@H]2OC3(CCCC3)O[C@@H]2C1 |
| InChI | InChI=1S/C12H20O5/c13-7-11(15)5-8(14)10-9(6-11)16-12(17-10)3-1-2-4-12/h8-10,13-15H,1-7H2/t8-,9-,10+,11-/m1/s1 |
| InChIKey | KWOYZIGHVIFPFK-CHWFTXMASA-N |
| XLogP | -0.08 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |