C15H20BrNO4 — CID 140685395
[(3R,6S,8R,9S,10S)-10-bromo-3-(2-isocyanoethyl)-2,7-dioxatricyclo[6.3.1.01,6]dodecan-9-yl] acetate (PubChem CID 140685395) has the molecular formula C15H20BrNO4 and a molecular weight of 358.23 g/mol. Its IUPAC name is [(3R,6S,8R,9S,10S)-10-bromo-3-(2-isocyanoethyl)-2,7-dioxatricyclo[6.3.1.01,6]dodecan-9-yl] acetate.
| Compound Name | [(3R,6S,8R,9S,10S)-10-bromo-3-(2-isocyanoethyl)-2,7-dioxatricyclo[6.3.1.01,6]dodecan-9-yl] acetate |
|---|---|
| PubChem CID | 140685395 |
| Molecular Formula | C15H20BrNO4 |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | [(3R,6S,8R,9S,10S)-10-bromo-3-(2-isocyanoethyl)-2,7-dioxatricyclo[6.3.1.01,6]dodecan-9-yl] acetate |
| SMILES | [C-]#[N+]CC[C@H]1CC[C@@H]2O[C@@H]3CC2(C[C@H](Br)[C@H]3OC(C)=O)O1 |
| InChI | InChI=1S/C15H20BrNO4/c1-9(18)19-14-11(16)7-15-8-12(14)20-13(15)4-3-10(21-15)5-6-17-2/h10-14H,3-8H2,1H3/t10-,11+,12-,13+,14-,15?/m1/s1 |
| InChIKey | AFSMRZALDRMBTO-WQFUOLRDSA-N |
| XLogP | 2.47 |
| TPSA | 49.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|