C27H44O9 — CID 160684160
methyl (E)-3-[(2R,7aS)-3a-(hydroxymethyl)-5-propyl-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]prop-2-enoate;(1R,6S,8R)-3-propyl-2,7,10-trioxatricyclo[6.3.1.01,6]dodecan-9-ol (PubChem CID 160684160) has the molecular formula C27H44O9 and a molecular weight of 512.64 g/mol. Its IUPAC name is methyl (E)-3-[(2R,7aS)-3a-(hydroxymethyl)-5-propyl-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]prop-2-enoate;(1R,6S,8R)-3-propyl-2,7,10-trioxatricyclo[6.3.1.01,6]dodecan-9-ol.
| Compound Name | methyl (E)-3-[(2R,7aS)-3a-(hydroxymethyl)-5-propyl-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]prop-2-enoate;(1R,6S,8R)-3-propyl-2,7,10-trioxatricyclo[6.3.1.01,6]dodecan-9-ol |
|---|---|
| PubChem CID | 160684160 |
| Molecular Formula | C27H44O9 |
| Molecular Weight | 512.64 g/mol |
| Exact Mass | 512.30 |
| IUPAC Name | methyl (E)-3-[(2R,7aS)-3a-(hydroxymethyl)-5-propyl-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]prop-2-enoate;(1R,6S,8R)-3-propyl-2,7,10-trioxatricyclo[6.3.1.01,6]dodecan-9-ol |
| SMILES | CCCC1CC[C@@H]2O[C@@H](/C=C/C(=O)OC)CC2(CO)O1.CCCC1CC[C@@H]2O[C@@H]3C[C@]2(COC3O)O1 |
| InChI | InChI=1S/C15H24O5.C12H20O4/c1-3-4-11-5-7-13-15(10-16,20-11)9-12(19-13)6-8-14(17)18-2;1-2-3-8-4-5-10-12(16-8)6-9(15-10)11(13)14-7-12/h6,8,11-13,16H,3-5,7,9-10H2,1-2H3;8-11,13H,2-7H2,1H3/b8-6+;/t11?,12-,13-,15?;8?,9-,10+,11?,12-/m01/s1 |
| InChIKey | RONOTCDLXOKLQN-VWYLEYKGSA-N |
| XLogP | 2.79 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.64 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|