C16H23NO5 — CID 74435783
methyl 3-[5-(2-cyanopropyl)-3a-(hydroxymethyl)-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]prop-2-enoate (PubChem CID 74435783) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is methyl 3-[5-(2-cyanopropyl)-3a-(hydroxymethyl)-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]prop-2-enoate.
| Compound Name | methyl 3-[5-(2-cyanopropyl)-3a-(hydroxymethyl)-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 74435783 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | methyl 3-[5-(2-cyanopropyl)-3a-(hydroxymethyl)-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]prop-2-enoate |
| SMILES | COC(=O)C=CC1CC2(CO)OC(CC(C)C#N)CCC2O1 |
| InChI | InChI=1S/C16H23NO5/c1-11(9-17)7-12-3-5-14-16(10-18,22-12)8-13(21-14)4-6-15(19)20-2/h4,6,11-14,18H,3,5,7-8,10H2,1-2H3 |
| InChIKey | IKBOKNUXODLFIO-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 88.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|