C15H22NO5+ — CID 163840194
[5-(2-cyanoethyl)-2-[(E)-3-methoxy-3-oxoprop-1-enyl]-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-3a-yl]methyloxidanium (PubChem CID 163840194) has the molecular formula C15H22NO5+ and a molecular weight of 296.34 g/mol. Its IUPAC name is [5-(2-cyanoethyl)-2-[(E)-3-methoxy-3-oxoprop-1-enyl]-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-3a-yl]methyloxidanium.
| Compound Name | [5-(2-cyanoethyl)-2-[(E)-3-methoxy-3-oxoprop-1-enyl]-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-3a-yl]methyloxidanium |
|---|---|
| PubChem CID | 163840194 |
| Molecular Formula | C15H22NO5+ |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | [5-(2-cyanoethyl)-2-[(E)-3-methoxy-3-oxoprop-1-enyl]-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-3a-yl]methyloxidanium |
| SMILES | COC(=O)/C=C/C1CC2(C[OH2+])OC(CCC#N)CCC2O1 |
| InChI | InChI=1S/C15H21NO5/c1-19-14(18)7-5-12-9-15(10-17)13(20-12)6-4-11(21-15)3-2-8-16/h5,7,11-13,17H,2-4,6,9-10H2,1H3/p+1/b7-5+ |
| InChIKey | OLHHJGNNMUYQRJ-FNORWQNLSA-O |
| XLogP | 0.82 |
| TPSA | 91.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|