C14H17NO4 — CID 89180525
3-[5-[(E)-3-oxoprop-1-enyl]-3,6,11-trioxatricyclo[5.4.0.01,4]undecan-10-yl]propanenitrile (PubChem CID 89180525) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is 3-[5-[(E)-3-oxoprop-1-enyl]-3,6,11-trioxatricyclo[5.4.0.01,4]undecan-10-yl]propanenitrile.
| Compound Name | 3-[5-[(E)-3-oxoprop-1-enyl]-3,6,11-trioxatricyclo[5.4.0.01,4]undecan-10-yl]propanenitrile |
|---|---|
| PubChem CID | 89180525 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 3-[5-[(E)-3-oxoprop-1-enyl]-3,6,11-trioxatricyclo[5.4.0.01,4]undecan-10-yl]propanenitrile |
| SMILES | N#CCCC1CCC2OC(/C=C/C=O)C3OCC23O1 |
| InChI | InChI=1S/C14H17NO4/c15-7-1-3-10-5-6-12-14(19-10)9-17-13(14)11(18-12)4-2-8-16/h2,4,8,10-13H,1,3,5-6,9H2/b4-2+ |
| InChIKey | GLPJFPISSRENOC-DUXPYHPUSA-N |
| XLogP | 1.13 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|