C15H24O3 — CID 134238063
1-[(1S,3R,6S,8R,10R)-9,10-dimethyl-2,7-dioxatricyclo[6.3.1.01,6]dodecan-3-yl]propan-2-one (PubChem CID 134238063) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is 1-[(1S,3R,6S,8R,10R)-9,10-dimethyl-2,7-dioxatricyclo[6.3.1.01,6]dodecan-3-yl]propan-2-one.
| Compound Name | 1-[(1S,3R,6S,8R,10R)-9,10-dimethyl-2,7-dioxatricyclo[6.3.1.01,6]dodecan-3-yl]propan-2-one |
|---|---|
| PubChem CID | 134238063 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 1-[(1S,3R,6S,8R,10R)-9,10-dimethyl-2,7-dioxatricyclo[6.3.1.01,6]dodecan-3-yl]propan-2-one |
| SMILES | CC(=O)C[C@H]1CC[C@@H]2O[C@@H]3C[C@]2(C[C@@H](C)C3C)O1 |
| InChI | InChI=1S/C15H24O3/c1-9-7-15-8-13(11(9)3)17-14(15)5-4-12(18-15)6-10(2)16/h9,11-14H,4-8H2,1-3H3/t9-,11?,12-,13-,14+,15+/m1/s1 |
| InChIKey | HYODWPNGXURAEH-HWQFWVQPSA-N |
| XLogP | 2.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |