C11H18O3 — CID 134238067
(1S,5S,7R,9R)-8,9-dimethyl-2,6-dioxatricyclo[5.3.1.01,5]undecan-3-ol (PubChem CID 134238067) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is (1S,5S,7R,9R)-8,9-dimethyl-2,6-dioxatricyclo[5.3.1.01,5]undecan-3-ol.
| Compound Name | (1S,5S,7R,9R)-8,9-dimethyl-2,6-dioxatricyclo[5.3.1.01,5]undecan-3-ol |
|---|---|
| PubChem CID | 134238067 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | (1S,5S,7R,9R)-8,9-dimethyl-2,6-dioxatricyclo[5.3.1.01,5]undecan-3-ol |
| SMILES | CC1[C@H](C)C[C@]23C[C@H]1O[C@H]2CC(O)O3 |
| InChI | InChI=1S/C11H18O3/c1-6-4-11-5-8(7(6)2)13-9(11)3-10(12)14-11/h6-10,12H,3-5H2,1-2H3/t6-,7?,8-,9+,10?,11+/m1/s1 |
| InChIKey | HHEBNTGNXRSVEH-TUMXGTQCSA-N |
| XLogP | 1.30 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |