C9H16O3 — CID 163498543
(5S,6R,7S)-5,7-dimethyl-4-oxaspiro[2.5]octane-2,6-diol (PubChem CID 163498543) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is (5S,6R,7S)-5,7-dimethyl-4-oxaspiro[2.5]octane-2,6-diol.
| Compound Name | (5S,6R,7S)-5,7-dimethyl-4-oxaspiro[2.5]octane-2,6-diol |
|---|---|
| PubChem CID | 163498543 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | (5S,6R,7S)-5,7-dimethyl-4-oxaspiro[2.5]octane-2,6-diol |
| SMILES | C[C@@H]1OC2(CC2O)C[C@H](C)[C@H]1O |
| InChI | InChI=1S/C9H16O3/c1-5-3-9(4-7(9)10)12-6(2)8(5)11/h5-8,10-11H,3-4H2,1-2H3/t5-,6-,7?,8+,9?/m0/s1 |
| InChIKey | CSTWINWSSSADCQ-KGZTYDNRSA-N |
| XLogP | 0.30 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |