C8H16O3 — CID 142953228
(1S,2R,4R,6R)-4,6-dimethylcyclohexane-1,2,4-triol (PubChem CID 142953228) has the molecular formula C8H16O3 and a molecular weight of 160.21 g/mol. Its IUPAC name is (1S,2R,4R,6R)-4,6-dimethylcyclohexane-1,2,4-triol.
| Compound Name | (1S,2R,4R,6R)-4,6-dimethylcyclohexane-1,2,4-triol |
|---|---|
| PubChem CID | 142953228 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | (1S,2R,4R,6R)-4,6-dimethylcyclohexane-1,2,4-triol |
| SMILES | C[C@@H]1C[C@@](C)(O)C[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C8H16O3/c1-5-3-8(2,11)4-6(9)7(5)10/h5-7,9-11H,3-4H2,1-2H3/t5-,6-,7+,8-/m1/s1 |
| InChIKey | AROJJVPUECDVCS-OOJXKGFFSA-N |
| XLogP | -0.11 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |